C19H30IN3O2 — CID 86770911
1-ethyl-3-(oxolan-2-ylmethyl)-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 86770911) has the molecular formula C19H30IN3O2 and a molecular weight of 459.37 g/mol. Its IUPAC name is 1-ethyl-3-(oxolan-2-ylmethyl)-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(oxolan-2-ylmethyl)-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 86770911 |
| Molecular Formula | C19H30IN3O2 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-ethyl-3-(oxolan-2-ylmethyl)-2-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCOC1c1ccccc1)NCC1CCCO1.I |
| InChI | InChI=1S/C19H29N3O2.HI/c1-2-20-19(22-14-17-9-6-11-23-17)21-13-16-10-12-24-18(16)15-7-4-3-5-8-15;/h3-5,7-8,16-18H,2,6,9-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | DJXKUPRIVUNLIF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|