C20H35N7O — CID 119157214
2-[(1-acetylpiperidin-4-yl)methyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine (PubChem CID 119157214) has the molecular formula C20H35N7O and a molecular weight of 389.55 g/mol. Its IUPAC name is 2-[(1-acetylpiperidin-4-yl)methyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine.
| Compound Name | 2-[(1-acetylpiperidin-4-yl)methyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
|---|---|
| PubChem CID | 119157214 |
| Molecular Formula | C20H35N7O |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | 2-[(1-acetylpiperidin-4-yl)methyl]-1-ethyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(C(C)=O)CC1)NC1CCCN(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C20H35N7O/c1-4-21-20(22-12-17-7-10-26(11-8-17)16(2)28)24-18-6-5-9-27(14-18)19-13-23-25(3)15-19/h13,15,17-18H,4-12,14H2,1-3H3,(H2,21,22,24) |
| InChIKey | ISMBNXRUDWJMPW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|