C17H31N5O2 — CID 111507767
1-[2-(2-hydroxyethyl)pentyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]urea (PubChem CID 111507767) has the molecular formula C17H31N5O2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethyl)pentyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]urea.
| Compound Name | 1-[2-(2-hydroxyethyl)pentyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 111507767 |
| Molecular Formula | C17H31N5O2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 1-[2-(2-hydroxyethyl)pentyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]urea |
| SMILES | CCCC(CCO)CNC(=O)NC1CCCN(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C17H31N5O2/c1-3-5-14(7-9-23)10-18-17(24)20-15-6-4-8-22(12-15)16-11-19-21(2)13-16/h11,13-15,23H,3-10,12H2,1-2H3,(H2,18,20,24) |
| InChIKey | VXLXBHASXWHQMA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |