C20H29N7O2 — CID 111995591
2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide (PubChem CID 111995591) has the molecular formula C20H29N7O2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 111995591 |
| Molecular Formula | C20H29N7O2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 2-[[ethylamino-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(O)cc1)NC1CCCN(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C20H29N7O2/c1-3-21-20(22-12-19(29)24-15-6-8-18(28)9-7-15)25-16-5-4-10-27(13-16)17-11-23-26(2)14-17/h6-9,11,14,16,28H,3-5,10,12-13H2,1-2H3,(H,24,29)(H2,21,22,25) |
| InChIKey | UEWRVMORBQBKFN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 106.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|