C18H28N4O2S — CID 111997273
2-[[ethylamino-[(3-ethylsulfanylcyclopentyl)amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide (PubChem CID 111997273) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-ethylsulfanylcyclopentyl)amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[[ethylamino-[(3-ethylsulfanylcyclopentyl)amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 111997273 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[[ethylamino-[(3-ethylsulfanylcyclopentyl)amino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(O)cc1)NC1CCC(SCC)C1 |
| InChI | InChI=1S/C18H28N4O2S/c1-3-19-18(22-14-7-10-16(11-14)25-4-2)20-12-17(24)21-13-5-8-15(23)9-6-13/h5-6,8-9,14,16,23H,3-4,7,10-12H2,1-2H3,(H,21,24)(H2,19,20,22) |
| InChIKey | YYDPBRJFHJXJTM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|