C17H28IN3OS — CID 111985512
1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111985512) has the molecular formula C17H28IN3OS and a molecular weight of 449.40 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985512 |
| Molecular Formula | C17H28IN3OS |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfanylcyclopentyl)-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(O)cc1)NC1CCC(SCC)C1.I |
| InChI | InChI=1S/C17H27N3OS.HI/c1-3-18-17(19-12-13-5-8-15(21)9-6-13)20-14-7-10-16(11-14)22-4-2;/h5-6,8-9,14,16,21H,3-4,7,10-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | PZLQZUXYQHPEAR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|