C21H34IN5O2S — CID 109396713
1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109396713) has the molecular formula C21H34IN5O2S and a molecular weight of 547.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109396713 |
| Molecular Formula | C21H34IN5O2S |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NCCc1c[nH]c2cccc(C)c12.I |
| InChI | InChI=1S/C21H33N5O2S.HI/c1-4-22-21(25-14-17-9-12-26(13-10-17)29(3,27)28)23-11-8-18-15-24-19-7-5-6-16(2)20(18)19;/h5-7,15,17,24H,4,8-14H2,1-3H3,(H2,22,23,25);1H |
| InChIKey | OQNUMKFAOCPGAR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|