C19H25IN4O — CID 110938671
1-ethyl-2-(furan-2-ylmethyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 110938671) has the molecular formula C19H25IN4O and a molecular weight of 452.34 g/mol. Its IUPAC name is 1-ethyl-2-(furan-2-ylmethyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110938671 |
| Molecular Formula | C19H25IN4O |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCc1c[nH]c2cccc(C)c12.I |
| InChI | InChI=1S/C19H24N4O.HI/c1-3-20-19(23-13-16-7-5-11-24-16)21-10-9-15-12-22-17-8-4-6-14(2)18(15)17;/h4-8,11-12,22H,3,9-10,13H2,1-2H3,(H2,20,21,23);1H |
| InChIKey | DYNHITRATHHFQB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|