C21H29IN4OS — CID 109419875
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 109419875) has the molecular formula C21H29IN4OS and a molecular weight of 512.46 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109419875 |
| Molecular Formula | C21H29IN4OS |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCc1c[nH]c2cccc(C)c12.I |
| InChI | InChI=1S/C21H28N4OS.HI/c1-4-22-20(25-14-21(3,26)18-9-6-12-27-18)23-11-10-16-13-24-17-8-5-7-15(2)19(16)17;/h5-9,12-13,24,26H,4,10-11,14H2,1-3H3,(H2,22,23,25);1H |
| InChIKey | XOJCSMYIWQTHGJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|