C20H25F3IN5S — CID 111689693
1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689693) has the molecular formula C20H25F3IN5S and a molecular weight of 551.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689693 |
| Molecular Formula | C20H25F3IN5S |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCCc1c[nH]c2cccc(C)c12.I |
| InChI | InChI=1S/C20H24F3N5S.HI/c1-3-24-19(26-10-8-17-28-16(12-29-17)20(21,22)23)25-9-7-14-11-27-15-6-4-5-13(2)18(14)15;/h4-6,11-12,27H,3,7-10H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | ODRVBEXJKRMQRB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|