C21H34N4O2S — CID 111635179
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111635179) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111635179 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NCCc1c[nH]c2cccc(C)c12 |
| InChI | InChI=1S/C21H34N4O2S/c1-6-22-20(25-15-21(3,4)11-13-28(5,26)27)23-12-10-17-14-24-18-9-7-8-16(2)19(17)18/h7-9,14,24H,6,10-13,15H2,1-5H3,(H2,22,23,25) |
| InChIKey | TXDSQPDDNSHCAW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|