C16H25F3N4O3S — CID 111559928
1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559928) has the molecular formula C16H25F3N4O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559928 |
| Molecular Formula | C16H25F3N4O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCCc1ccco1 |
| InChI | InChI=1S/C16H25F3N4O3S/c1-2-20-15(21-8-5-14-4-3-11-26-14)22-12-13-6-9-23(10-7-13)27(24,25)16(17,18)19/h3-4,11,13H,2,5-10,12H2,1H3,(H2,20,21,22) |
| InChIKey | KTJQNKUGBOOGJD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|