C14H27F3IN5O3S — CID 111559937
N-[2-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111559937) has the molecular formula C14H27F3IN5O3S and a molecular weight of 529.37 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111559937 |
| Molecular Formula | C14H27F3IN5O3S |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCCNC(C)=O.I |
| InChI | InChI=1S/C14H26F3N5O3S.HI/c1-3-18-13(20-7-6-19-11(2)23)21-10-12-4-8-22(9-5-12)26(24,25)14(15,16)17;/h12H,3-10H2,1-2H3,(H,19,23)(H2,18,20,21);1H |
| InChIKey | KYULSQVROZQTTJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|