C17H30F3N5O3S — CID 111560158
N-cyclopropyl-4-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]butanamide (PubChem CID 111560158) has the molecular formula C17H30F3N5O3S and a molecular weight of 441.52 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111560158 |
| Molecular Formula | C17H30F3N5O3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-cyclopropyl-4-[[N-ethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]carbamimidoyl]amino]butanamide |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C17H30F3N5O3S/c1-2-21-16(22-9-3-4-15(26)24-14-5-6-14)23-12-13-7-10-25(11-8-13)29(27,28)17(18,19)20/h13-14H,2-12H2,1H3,(H,24,26)(H2,21,22,23) |
| InChIKey | QLZRMECMPPYZGS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|