C17H30F3IN6O2S — CID 111560045
1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111560045) has the molecular formula C17H30F3IN6O2S and a molecular weight of 566.43 g/mol. Its IUPAC name is 1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111560045 |
| Molecular Formula | C17H30F3IN6O2S |
| Molecular Weight | 566.43 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCCCc1cn[nH]c1C.I |
| InChI | InChI=1S/C17H29F3N6O2S.HI/c1-3-21-16(22-8-4-5-15-12-24-25-13(15)2)23-11-14-6-9-26(10-7-14)29(27,28)17(18,19)20;/h12,14H,3-11H2,1-2H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | LGSBZDQPWKHVBQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|