C14H27F3N4O2S — CID 111559306
1-butyl-3-ethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559306) has the molecular formula C14H27F3N4O2S and a molecular weight of 372.46 g/mol. Its IUPAC name is 1-butyl-3-ethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-butyl-3-ethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559306 |
| Molecular Formula | C14H27F3N4O2S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-butyl-3-ethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCCCN/C(=N/CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCC |
| InChI | InChI=1S/C14H27F3N4O2S/c1-3-5-8-19-13(18-4-2)20-11-12-6-9-21(10-7-12)24(22,23)14(15,16)17/h12H,3-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | CUQVPJAODAEJOC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|