C17H27F3N4O3S — CID 110058638
2-butyl-1-[2-(furan-2-yl)ethyl]-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine (PubChem CID 110058638) has the molecular formula C17H27F3N4O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-butyl-1-[2-(furan-2-yl)ethyl]-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine.
| Compound Name | 2-butyl-1-[2-(furan-2-yl)ethyl]-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 110058638 |
| Molecular Formula | C17H27F3N4O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-butyl-1-[2-(furan-2-yl)ethyl]-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine |
| SMILES | CCCC/N=C(\NCCc1ccco1)NC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H27F3N4O3S/c1-2-3-9-21-16(22-10-6-15-5-4-13-27-15)23-14-7-11-24(12-8-14)28(25,26)17(18,19)20/h4-5,13-14H,2-3,6-12H2,1H3,(H2,21,22,23) |
| InChIKey | NDWQJKFETPMWCR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|