C17H30N4O4S — CID 110054174
1-(1-ethylsulfonylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine (PubChem CID 110054174) has the molecular formula C17H30N4O4S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-(1-ethylsulfonylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine.
| Compound Name | 1-(1-ethylsulfonylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 110054174 |
| Molecular Formula | C17H30N4O4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-(1-ethylsulfonylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine |
| SMILES | CCS(=O)(=O)N1CCC(N/C(=N/CCOC)NCCc2ccco2)CC1 |
| InChI | InChI=1S/C17H30N4O4S/c1-3-26(22,23)21-11-7-15(8-12-21)20-17(19-10-14-24-2)18-9-6-16-5-4-13-25-16/h4-5,13,15H,3,6-12,14H2,1-2H3,(H2,18,19,20) |
| InChIKey | NSYXDRPKQGFQCY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|