C16H26F3IN4O4S — CID 111982764
1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111982764) has the molecular formula C16H26F3IN4O4S and a molecular weight of 554.37 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111982764 |
| Molecular Formula | C16H26F3IN4O4S |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C16H25F3N4O4S.HI/c1-2-20-15(22-11-13(24)14-4-3-9-27-14)21-10-12-5-7-23(8-6-12)28(25,26)16(17,18)19;/h3-4,9,12-13,24H,2,5-8,10-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | DVNOHLDSQAPKCX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|