C15H24F3N5O2S2 — CID 111559586
1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559586) has the molecular formula C15H24F3N5O2S2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559586 |
| Molecular Formula | C15H24F3N5O2S2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 1-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H24F3N5O2S2/c1-3-19-14(22-10-13-9-20-11(2)26-13)21-8-12-4-6-23(7-5-12)27(24,25)15(16,17)18/h9,12H,3-8,10H2,1-2H3,(H2,19,21,22) |
| InChIKey | AOCVZUUIPAQJPN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|