C18H26F3N5O3S — CID 111559710
3-[[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]methyl]benzamide (PubChem CID 111559710) has the molecular formula C18H26F3N5O3S and a molecular weight of 449.50 g/mol. Its IUPAC name is 3-[[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]methyl]benzamide.
| Compound Name | 3-[[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111559710 |
| Molecular Formula | C18H26F3N5O3S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-[[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N5O3S/c1-2-23-17(25-12-14-4-3-5-15(10-14)16(22)27)24-11-13-6-8-26(9-7-13)30(28,29)18(19,20)21/h3-5,10,13H,2,6-9,11-12H2,1H3,(H2,22,27)(H2,23,24,25) |
| InChIKey | LKCBAJRAWGFRKN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|