C16H30F3N5O3S — CID 111559288
N-tert-butyl-2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]acetamide (PubChem CID 111559288) has the molecular formula C16H30F3N5O3S and a molecular weight of 429.51 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111559288 |
| Molecular Formula | C16H30F3N5O3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H30F3N5O3S/c1-5-20-14(22-11-13(25)23-15(2,3)4)21-10-12-6-8-24(9-7-12)28(26,27)16(17,18)19/h12H,5-11H2,1-4H3,(H,23,25)(H2,20,21,22) |
| InChIKey | IERAQDGRQLVAJL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|