C16H35IN6O — CID 111831693
N-tert-butyl-2-[[[(1,4-dimethylpiperazin-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111831693) has the molecular formula C16H35IN6O and a molecular weight of 454.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[[(1,4-dimethylpiperazin-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[[(1,4-dimethylpiperazin-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111831693 |
| Molecular Formula | C16H35IN6O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-tert-butyl-2-[[[(1,4-dimethylpiperazin-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC1CN(C)CCN1C.I |
| InChI | InChI=1S/C16H34N6O.HI/c1-7-17-15(19-11-14(23)20-16(2,3)4)18-10-13-12-21(5)8-9-22(13)6;/h13H,7-12H2,1-6H3,(H,20,23)(H2,17,18,19);1H |
| InChIKey | OSLRPEBPNCOJCM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|