C15H31N5O — CID 111384205
N-tert-butyl-2-[[ethylamino-[(1-methylpyrrolidin-3-yl)methylamino]methylidene]amino]acetamide (PubChem CID 111384205) has the molecular formula C15H31N5O and a molecular weight of 297.45 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[(1-methylpyrrolidin-3-yl)methylamino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[(1-methylpyrrolidin-3-yl)methylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111384205 |
| Molecular Formula | C15H31N5O |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[(1-methylpyrrolidin-3-yl)methylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC1CCN(C)C1 |
| InChI | InChI=1S/C15H31N5O/c1-6-16-14(17-9-12-7-8-20(5)11-12)18-10-13(21)19-15(2,3)4/h12H,6-11H2,1-5H3,(H,19,21)(H2,16,17,18) |
| InChIKey | BDGYFDLEBKCLRT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|