C22H37N5O — CID 111383822
N-tert-butyl-2-[[ethylamino-[[1-(2-phenylethyl)pyrrolidin-3-yl]methylamino]methylidene]amino]acetamide (PubChem CID 111383822) has the molecular formula C22H37N5O and a molecular weight of 387.57 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[[1-(2-phenylethyl)pyrrolidin-3-yl]methylamino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[[1-(2-phenylethyl)pyrrolidin-3-yl]methylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111383822 |
| Molecular Formula | C22H37N5O |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[[1-(2-phenylethyl)pyrrolidin-3-yl]methylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC1CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C22H37N5O/c1-5-23-21(25-16-20(28)26-22(2,3)4)24-15-19-12-14-27(17-19)13-11-18-9-7-6-8-10-18/h6-10,19H,5,11-17H2,1-4H3,(H,26,28)(H2,23,24,25) |
| InChIKey | BERDGEZTQIHXBK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|