C18H29N5O2 — CID 111383766
N-benzyl-2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]acetamide (PubChem CID 111383766) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-benzyl-2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]acetamide.
| Compound Name | N-benzyl-2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383766 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-benzyl-2-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H29N5O2/c1-5-19-17(22-13-16(25)23-18(2,3)4)21-12-15(24)20-11-14-9-7-6-8-10-14/h6-10H,5,11-13H2,1-4H3,(H,20,24)(H,23,25)(H2,19,21,22) |
| InChIKey | CKYNSYNZJQBDGE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|