C15H24N4O — CID 110965255
N-benzyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide (PubChem CID 110965255) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is N-benzyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide.
| Compound Name | N-benzyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide |
|---|---|
| PubChem CID | 110965255 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N-benzyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide |
| SMILES | C/N=C(/NCC(=O)NCc1ccccc1)NC(C)(C)C |
| InChI | InChI=1S/C15H24N4O/c1-15(2,3)19-14(16-4)18-11-13(20)17-10-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3,(H,17,20)(H2,16,18,19) |
| InChIKey | GRSNICOFSMJXJV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|