C15H22N4O — CID 111867274
N-benzyl-2-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111867274) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-benzyl-2-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-benzyl-2-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111867274 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-benzyl-2-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCC(=O)NCc1ccccc1)NCC1CC1 |
| InChI | InChI=1S/C15H22N4O/c1-16-15(18-10-13-7-8-13)19-11-14(20)17-9-12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,17,20)(H2,16,18,19) |
| InChIKey | UHZZPDUWKJWXJL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|