C19H38N6O2 — CID 111383223
1-[4-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide (PubChem CID 111383223) has the molecular formula C19H38N6O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[4-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111383223 |
| Molecular Formula | C19H38N6O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 1-[4-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCCCN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H38N6O2/c1-5-21-18(23-14-16(26)24-19(2,3)4)22-10-6-7-11-25-12-8-15(9-13-25)17(20)27/h15H,5-14H2,1-4H3,(H2,20,27)(H,24,26)(H2,21,22,23) |
| InChIKey | BJPAUHJKRNGIGA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|