C16H34IN5O2 — CID 110972314
N-tert-butyl-2-[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110972314) has the molecular formula C16H34IN5O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110972314 |
| Molecular Formula | C16H34IN5O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C16H33N5O2.HI/c1-5-17-15(19-13-14(22)20-16(2,3)4)18-7-6-8-21-9-11-23-12-10-21;/h5-13H2,1-4H3,(H,20,22)(H2,17,18,19);1H |
| InChIKey | DWVKSYOVDCRQBT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|