C20H40N6O3 — CID 111884855
tert-butyl N-[2-[[N'-[4-(4-carbamoylpiperidin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111884855) has the molecular formula C20H40N6O3 and a molecular weight of 412.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[4-(4-carbamoylpiperidin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N'-[4-(4-carbamoylpiperidin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111884855 |
| Molecular Formula | C20H40N6O3 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl N-[2-[[N'-[4-(4-carbamoylpiperidin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCCCN1CCC(C(N)=O)CC1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N6O3/c1-5-22-18(24-11-12-25-19(28)29-20(2,3)4)23-10-6-7-13-26-14-8-16(9-15-26)17(21)27/h16H,5-15H2,1-4H3,(H2,21,27)(H,25,28)(H2,22,23,24) |
| InChIKey | PQFGDJFUSCWKSJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|