C16H33N5O2 — CID 110940018
1-[4-[[ethylamino-(2-methoxyethylamino)methylidene]amino]butyl]piperidine-4-carboxamide (PubChem CID 110940018) has the molecular formula C16H33N5O2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[4-[[ethylamino-(2-methoxyethylamino)methylidene]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[ethylamino-(2-methoxyethylamino)methylidene]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110940018 |
| Molecular Formula | C16H33N5O2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 1-[4-[[ethylamino-(2-methoxyethylamino)methylidene]amino]butyl]piperidine-4-carboxamide |
| SMILES | CCN/C(=N\CCCCN1CCC(C(N)=O)CC1)NCCOC |
| InChI | InChI=1S/C16H33N5O2/c1-3-18-16(20-9-13-23-2)19-8-4-5-10-21-11-6-14(7-12-21)15(17)22/h14H,3-13H2,1-2H3,(H2,17,22)(H2,18,19,20) |
| InChIKey | OQHJFWUKYZZAGR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|