C16H31F3IN5O3S — CID 111560075
2-[[butylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111560075) has the molecular formula C16H31F3IN5O3S and a molecular weight of 557.42 g/mol. Its IUPAC name is 2-[[butylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[butylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111560075 |
| Molecular Formula | C16H31F3IN5O3S |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | 2-[[butylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCN/C(=N\CC(=O)N(C)C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C16H30F3N5O3S.HI/c1-4-5-8-20-15(22-12-14(25)23(2)3)21-11-13-6-9-24(10-7-13)28(26,27)16(17,18)19;/h13H,4-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | QYGWHVLXPHTAAM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|