C14H26F3N5O3S — CID 111559806
2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111559806) has the molecular formula C14H26F3N5O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111559806 |
| Molecular Formula | C14H26F3N5O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-[[ethylamino-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H26F3N5O3S/c1-4-18-13(20-10-12(23)21(2)3)19-9-11-5-7-22(8-6-11)26(24,25)14(15,16)17/h11H,4-10H2,1-3H3,(H2,18,19,20) |
| InChIKey | NMCCVZNAXRHFKM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|