C12H23F3N4O2S — CID 111559792
3-ethyl-1,1-dimethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559792) has the molecular formula C12H23F3N4O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 3-ethyl-1,1-dimethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 3-ethyl-1,1-dimethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559792 |
| Molecular Formula | C12H23F3N4O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-ethyl-1,1-dimethyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N/CC1CCN(S(=O)(=O)C(F)(F)F)CC1)N(C)C |
| InChI | InChI=1S/C12H23F3N4O2S/c1-4-16-11(18(2)3)17-9-10-5-7-19(8-6-10)22(20,21)12(13,14)15/h10H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | QKZAITHMXJWFIS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|