C16H29F3N4O3S — CID 111982761
1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111982761) has the molecular formula C16H29F3N4O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111982761 |
| Molecular Formula | C16H29F3N4O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(O)CCCC1)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H29F3N4O3S/c1-2-20-14(22-12-15(24)7-3-4-8-15)21-11-13-5-9-23(10-6-13)27(25,26)16(17,18)19/h13,24H,2-12H2,1H3,(H2,20,21,22) |
| InChIKey | OQBXSNVSPPWMRC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|