C21H39F3IN5O — CID 110035912
2-[[(cyclohexylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035912) has the molecular formula C21H39F3IN5O and a molecular weight of 561.48 g/mol. Its IUPAC name is 2-[[(cyclohexylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclohexylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035912 |
| Molecular Formula | C21H39F3IN5O |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 2-[[(cyclohexylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCC1CCN(CC(F)(F)F)CC1)NCC1CCCCC1.I |
| InChI | InChI=1S/C21H38F3N5O.HI/c1-28(2)19(30)15-27-20(26-14-18-6-4-3-5-7-18)25-11-8-17-9-12-29(13-10-17)16-21(22,23)24;/h17-18H,3-16H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | RSZAKMMYGXDTFS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|