C13H24N4OS — CID 111605869
1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine (PubChem CID 111605869) has the molecular formula C13H24N4OS and a molecular weight of 284.43 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111605869 |
| Molecular Formula | C13H24N4OS |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-ethyl-3-(2-methoxy-2-methylpropyl)-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)NCC(C)(C)OC |
| InChI | InChI=1S/C13H24N4OS/c1-6-14-12(17-9-13(3,4)18-5)16-8-11-7-15-10(2)19-11/h7H,6,8-9H2,1-5H3,(H2,14,16,17) |
| InChIKey | XZHAEZPNLNGXJC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|