C19H30N4O4S — CID 111786485
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethylguanidine (PubChem CID 111786485) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111786485 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCC1CCC1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H30N4O4S/c1-2-20-19(22-10-11-28(24,25)23-13-16-4-3-5-16)21-9-8-15-6-7-17-18(12-15)27-14-26-17/h6-7,12,16,23H,2-5,8-11,13-14H2,1H3,(H2,20,21,22) |
| InChIKey | XSLZXBQCAFHMOR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|