C18H27IN4O3 — CID 111379982
N-[2-[[N'-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111379982) has the molecular formula C18H27IN4O3 and a molecular weight of 474.34 g/mol. Its IUPAC name is N-[2-[[N'-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111379982 |
| Molecular Formula | C18H27IN4O3 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[2-[[N'-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc2c(c1)OCO2)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C18H26N4O3.HI/c1-2-19-18(22-10-9-20-17(23)14-4-5-14)21-8-7-13-3-6-15-16(11-13)25-12-24-15;/h3,6,11,14H,2,4-5,7-10,12H2,1H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | PPDQZVKAEZCGMR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|