C14H22N4O4S — CID 111381039
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine (PubChem CID 111381039) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111381039 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H22N4O4S/c1-2-16-14(18-7-8-23(15,19)20)17-6-5-11-3-4-12-13(9-11)22-10-21-12/h3-4,9H,2,5-8,10H2,1H3,(H2,15,19,20)(H2,16,17,18) |
| InChIKey | LIHHCYICVSGKRI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|