C17H30N4O4S — CID 111246415
1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine (PubChem CID 111246415) has the molecular formula C17H30N4O4S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111246415 |
| Molecular Formula | C17H30N4O4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)NCCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C17H30N4O4S/c1-4-19-17(21-11-12-26(18,22)23)20-10-9-14-7-8-15(24-5-2)16(13-14)25-6-3/h7-8,13H,4-6,9-12H2,1-3H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | SLSLEVGXIYBXCE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|