C20H36N4O4S — CID 111783210
1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine (PubChem CID 111783210) has the molecular formula C20H36N4O4S and a molecular weight of 428.60 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine |
|---|---|
| PubChem CID | 111783210 |
| Molecular Formula | C20H36N4O4S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)NCCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C20H36N4O4S/c1-7-21-19(23-15-20(4,5)24-29(6,25)26)22-13-12-16-10-11-17(27-8-2)18(14-16)28-9-3/h10-11,14,24H,7-9,12-13,15H2,1-6H3,(H2,21,22,23) |
| InChIKey | QAAMOPXKTADCLF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|