C16H28ClIN4O2S — CID 111785840
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 111785840) has the molecular formula C16H28ClIN4O2S and a molecular weight of 502.85 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111785840 |
| Molecular Formula | C16H28ClIN4O2S |
| Molecular Weight | 502.85 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C16H27ClN4O2S.HI/c1-5-18-15(20-12-16(2,3)21-24(4,22)23)19-10-9-13-7-6-8-14(17)11-13;/h6-8,11,21H,5,9-10,12H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | GYPAUGCXKWEODA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|