C16H28N4O2S2 — CID 111786275
1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111786275) has the molecular formula C16H28N4O2S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111786275 |
| Molecular Formula | C16H28N4O2S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C16H28N4O2S2/c1-5-17-15(19-13-16(2,3)20-24(4,21)22)18-11-12-23-14-9-7-6-8-10-14/h6-10,20H,5,11-13H2,1-4H3,(H2,17,18,19) |
| InChIKey | ZITJSFXDGJBQPO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|