C18H31ClIN3O2S2 — CID 111634906
1-[2-(4-chlorophenyl)sulfanylethyl]-2-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethylguanidine;hydroiodide (PubChem CID 111634906) has the molecular formula C18H31ClIN3O2S2 and a molecular weight of 547.96 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-2-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111634906 |
| Molecular Formula | C18H31ClIN3O2S2 |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NCCSc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C18H30ClN3O2S2.HI/c1-5-20-17(22-14-18(2,3)10-13-26(4,23)24)21-11-12-25-16-8-6-15(19)7-9-16;/h6-9H,5,10-14H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | QOLMRUYRUPKDCX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|