C13H21ClN4O2S2 — CID 111372333
1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine (PubChem CID 111372333) has the molecular formula C13H21ClN4O2S2 and a molecular weight of 364.92 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111372333 |
| Molecular Formula | C13H21ClN4O2S2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H21ClN4O2S2/c1-2-16-13(18-8-10-22(15,19)20)17-7-9-21-12-5-3-11(14)4-6-12/h3-6H,2,7-10H2,1H3,(H2,15,19,20)(H2,16,17,18) |
| InChIKey | QNPBKXJSDOURJU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|