C18H29ClN4OS — CID 110972667
1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 110972667) has the molecular formula C18H29ClN4OS and a molecular weight of 384.98 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 110972667 |
| Molecular Formula | C18H29ClN4OS |
| Molecular Weight | 384.98 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H29ClN4OS/c1-2-20-18(21-8-3-10-23-11-13-24-14-12-23)22-9-15-25-17-6-4-16(19)5-7-17/h4-7H,2-3,8-15H2,1H3,(H2,20,21,22) |
| InChIKey | MKOIWENXDDNZDN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.98 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|