C13H19Cl3N4O3S — CID 109464372
1-ethyl-2-(2-sulfamoylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine (PubChem CID 109464372) has the molecular formula C13H19Cl3N4O3S and a molecular weight of 417.75 g/mol. Its IUPAC name is 1-ethyl-2-(2-sulfamoylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-sulfamoylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 109464372 |
| Molecular Formula | C13H19Cl3N4O3S |
| Molecular Weight | 417.75 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 1-ethyl-2-(2-sulfamoylethyl)-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl3N4O3S/c1-2-18-13(20-4-6-24(17,21)22)19-3-5-23-12-10(15)7-9(14)8-11(12)16/h7-8H,2-6H2,1H3,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | RIIFJIFPDFYYPZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|