C16H21Cl3N4O2 — CID 109464460
N-cyclopropyl-2-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]acetamide (PubChem CID 109464460) has the molecular formula C16H21Cl3N4O2 and a molecular weight of 407.73 g/mol. Its IUPAC name is N-cyclopropyl-2-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]acetamide.
| Compound Name | N-cyclopropyl-2-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 109464460 |
| Molecular Formula | C16H21Cl3N4O2 |
| Molecular Weight | 407.73 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | N-cyclopropyl-2-[[ethylamino-[2-(2,4,6-trichlorophenoxy)ethylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl3N4O2/c1-2-20-16(22-9-14(24)23-11-3-4-11)21-5-6-25-15-12(18)7-10(17)8-13(15)19/h7-8,11H,2-6,9H2,1H3,(H,23,24)(H2,20,21,22) |
| InChIKey | HWZAOEKJPXSWHT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|